CAS 930-42-7

Isothiazole,4-bromo-3-methyl-

Description:

Isothiazole, 4-bromo-3-methyl- is a heterocyclic compound characterized by a five-membered ring containing both nitrogen and sulfur atoms. The presence of a bromine atom at the 4-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in various fields, including agrochemicals and pharmaceuticals. Isothiazoles are recognized for their biological activity, often displaying antimicrobial and antifungal properties. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the compound's structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, Isothiazole, 4-bromo-3-methyl- is an important compound in the realm of chemical research and application.

Formula: C₄H₄BrNS

InChI: InChI=1S/C4H4BrNS/c1-3-4(5)2-7-6-3/h2H,1H3

InChI key: IXHNFDZCYLIMQS-UHFFFAOYSA-N

SMILES: CC1=NSC=C1Br

Synonyms:

• 4-Bromo-3-methylisothiazole
• 4-Bromo-3-methyl-isothiazole
• Isothiazole,4-broMo-3-Methyl-

4-Bromo-3-methylisothiazole

CAS: 930-42-7

4-Bromo-3-methylisothiazole

Formula: C₄H₄BrNS

Purity: 95%

Color and Shape: Liquid

Molecular weight: 178.05025

Ref: 54-OR346459

4-bromo-3-methylisothiazole

CAS: 930-42-7

Formula: C₄H₄BrNS

Purity: 95%

Color and Shape: Liquid

Molecular weight: 178.0503

Ref: IN-DA006J5P

4-Bromo-3-methylisothiazole

CAS: 930-42-7

4-Bromo-3-methylisothiazole is an industrial chemical that is used in the production of olefins. It reacts with other compounds to form alkyl derivatives, such as acetylenes and lithium 4-bromo-3-methylisothiazole. This compound is also a source for isothiazoles, which are unsubstituted pyridines. The reactivity of 4-bromo-3-methylisothiazole depends on the presence or absence of substituents.

Formula: C₄H₄BrNS

Purity: Min. 95%

Molecular weight: 178.05 g/mol

Ref: 3D-AAA93042