CymitQuimica logo

CAS 930-50-7

:

Cyclopropanemethanol, 2,2-dimethyl-

Description:
Cyclopropanemethanol, 2,2-dimethyl- (CAS 930-50-7) is an organic compound characterized by its unique cyclopropane ring structure fused with a methanol group. This compound features a three-membered cyclopropane ring, which contributes to its strain and reactivity, along with a hydroxymethyl group (-CH2OH) attached to a carbon that is also substituted with two methyl groups. The presence of these substituents influences its physical and chemical properties, such as boiling point, solubility, and reactivity. Typically, cyclopropane derivatives exhibit interesting behavior in chemical reactions due to the ring strain, making them valuable in synthetic organic chemistry. The compound is likely to be a colorless liquid at room temperature, with potential applications in various fields, including pharmaceuticals and agrochemicals. Its reactivity can be attributed to the strained cyclopropane ring, which can undergo ring-opening reactions under certain conditions, leading to the formation of more stable products. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H12O
InChI:InChI=1S/C6H12O/c1-6(2)3-5(6)4-7/h5,7H,3-4H2,1-2H3
InChI key:HCRFKZNNRFJHKW-UHFFFAOYSA-N
SMILES:CC1(CC1CO)C
Found 3 products.