CymitQuimica logo

CAS 930-84-7

:

4-Iodo-3-methyl-5-isoxazolamine

Description:
4-Iodo-3-methyl-5-isoxazolamine is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of an iodine atom at the 4-position and a methyl group at the 3-position of the isoxazole ring contributes to its distinct chemical properties. This compound is typically classified as an aromatic amine due to the presence of an amino group, which can participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, safety considerations are important when handling this substance, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 4-Iodo-3-methyl-5-isoxazolamine is of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C4H5IN2O
InChI:InChI=1S/C4H5IN2O/c1-2-3(5)4(6)8-7-2/h6H2,1H3
InChI key:InChIKey=QYDXMTSFXGDDNY-UHFFFAOYSA-N
SMILES:IC=1C(C)=NOC1N
Synonyms:
  • 4-Iodo-3-methyl-5-isoxazolamine
  • 5-Isoxazolamine, 4-iodo-3-methyl-
  • Isoxazole, 5-amino-4-iodo-3-methyl-
Found 3 products.