CymitQuimica logo

CAS 930-87-0

:

1,2,5-Trimethyl-1H-pyrrole

Description:
1,2,5-Trimethyl-1H-pyrrole is a heterocyclic organic compound characterized by a five-membered ring containing one nitrogen atom and four carbon atoms. Its molecular structure features three methyl groups attached to the pyrrole ring at the 1, 2, and 5 positions, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. 1,2,5-Trimethyl-1H-pyrrole is known for its role in various chemical reactions, including its potential as a building block in organic synthesis and its applications in the production of dyes, pharmaceuticals, and agrochemicals. The presence of the nitrogen atom in the ring imparts basic properties, allowing it to participate in electrophilic and nucleophilic reactions. Additionally, its structure can influence its reactivity and interactions with other chemical species, making it a subject of interest in both academic and industrial research.
Formula:C7H11N
InChI:InChI=1/C7H11N/c1-6-4-5-7(2)8(6)3/h4-5H,1-3H3
InChI key:InChIKey=YRABRACUKBOTKB-UHFFFAOYSA-N
SMILES:CN1C(C)=CC=C1C
Synonyms:
  • 1,2,5-trimethyl-1H-pyrrole
  • 1H-Pyrrole, 1,2,5-trimethyl-
  • Nsc 81220
  • Pyrrole, 1,2,5-trimethyl-
  • 1,2,5-Trimethylpyrrole
Found 5 products.