CAS 930-96-1
:3-Bromothiophene-2-carboxaldehyde
Description:
3-Bromothiophene-2-carboxaldehyde is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 3-position and an aldehyde functional group at the 2-position significantly influences its chemical reactivity and properties. This compound typically appears as a yellow to brown liquid or solid, depending on its purity and form. It is known for its role in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The aldehyde group makes it a versatile intermediate for further chemical transformations, such as condensation reactions and nucleophilic additions. Additionally, the bromine substituent can participate in electrophilic aromatic substitution reactions, enhancing its utility in synthetic chemistry. 3-Bromothiophene-2-carboxaldehyde is also of interest in materials science and can exhibit interesting electronic properties due to its conjugated system. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C5H3BrOS
InChI:InChI=1/C5H3BrOS/c6-4-1-2-8-5(4)3-7/h1-3H
InChI key:BCZHCWCOQDRYGS-UHFFFAOYSA-N
SMILES:c1csc(C=O)c1Br
Synonyms:- 3-Bromothiophene-2-carbaldehyde
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Bromothiophene-2-carboxaldehyde
CAS:Formula:C5H3BrOSPurity:>95.0%(GC)Color and Shape:Light yellow to Amber to Dark green clear liquidMolecular weight:191.043-Bromothiophene-2-carboxaldehyde
CAS:3-Bromothiophene-2-carboxaldehydeFormula:C5H3BrOSPurity:≥95%Color and Shape:Solid-Low MeltMolecular weight:191.045723-Bromothiophene-2-carboxaldehyde
CAS:Formula:C5H3BrOSPurity:97%Color and Shape:SolidMolecular weight:191.04573-Bromothiophene-2-carboxaldehyde
CAS:3-Bromothiophene-2-carboxaldehydeFormula:C5H3BrOSPurity:95%Molecular weight:191.053-Bromothiophene-2-carboxaldehyde
CAS:Formula:C5H3BrOSPurity:95%Color and Shape:LiquidMolecular weight:191.043-Bromothiophene-2-carbaldehyde
CAS:3-Bromothiophene-2-carbaldehyde is an organic compound that has been shown to have antibacterial activity. It can be synthesized by reacting triethyl orthoformate with methyl ketones in the presence of a photocatalyst such as titanium dioxide or zinc oxide. This reaction produces 3-bromothiophene-2-carboxylic acid which reacts with ammonia and hydrogen bromide to form 3-bromothiophene-2-carbaldehyde. 3-Bromothiophene-2-carbaldehyde has been shown to inhibit the growth of cancer cells and induce apoptosis, which may be due to its ability to inhibit angiogenesis. The anticancer properties are most likely due to its ability to bind DNA and inhibit protein synthesis, leading to cell death.
Formula:C5H3BrOSPurity:Min. 95%Color and Shape:White To Yellow To Light Brown SolidMolecular weight:191.05 g/mol





