CymitQuimica logo

CAS 930-97-2

:

3-Iodo-2-thiophenecarboxaldehyde

Description:
3-Iodo-2-thiophenecarboxaldehyde is an organic compound characterized by the presence of both an aldehyde functional group and a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features an iodine atom substituted at the 3-position of the thiophene ring, which can influence its reactivity and physical properties. Typically, compounds like this exhibit a range of chemical behaviors, including electrophilic aromatic substitution due to the electron-withdrawing nature of the aldehyde and iodine substituents. The presence of the thiophene ring often imparts unique electronic properties, making it useful in various applications, including organic synthesis and materials science. Additionally, the compound may exhibit moderate solubility in organic solvents and can participate in various chemical reactions, such as nucleophilic additions and coupling reactions. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C5H3IOS
InChI:InChI=1S/C5H3IOS/c6-4-1-2-8-5(4)3-7/h1-3H
InChI key:InChIKey=PRIIWJLXEOFRPP-UHFFFAOYSA-N
SMILES:C(=O)C1=C(I)C=CS1
Synonyms:
  • 3-Iodo-2-thiophenecarboxaldehyde
  • 2-Thiophenecarboxaldehyde, 3-iodo-
  • 3-Iodothiophene-2-carbaldehyde
  • 2-Formyl-3-iodothiophene
  • 3-Iodo-2-formylthiophene
Found 2 products.