CymitQuimica logo

CAS 930110-99-9

:

5-(2-Furanyl)-2-pyridinecarboxylic acid

Description:
5-(2-Furanyl)-2-pyridinecarboxylic acid, with the CAS number 930110-99-9, is an organic compound characterized by the presence of both a pyridine and a furan ring in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The furan ring, a five-membered aromatic heterocycle containing oxygen, imparts unique electronic properties, while the pyridine ring, a six-membered aromatic heterocycle containing nitrogen, adds to the compound's basicity and potential for coordination with metal ions. The presence of these two heterocycles suggests that the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, its solubility and stability can be influenced by the functional groups present, which may affect its applications in various chemical reactions or as a potential pharmaceutical agent. Overall, 5-(2-Furanyl)-2-pyridinecarboxylic acid is a versatile compound with potential implications in both synthetic and medicinal chemistry.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-10(13)8-4-3-7(6-11-8)9-2-1-5-14-9/h1-6H,(H,12,13)
InChI key:InChIKey=LTWJYKGQIACFMN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CC(=CN1)C2=CC=CO2
Synonyms:
  • 5-(Furan-2-yl)pyridine-2-carboxylic acid
  • 2-Pyridinecarboxylic acid, 5-(2-furanyl)-
  • 5-(2-Furanyl)-2-pyridinecarboxylic acid
Found 2 products.