CymitQuimica logo

CAS 930111-15-2

:

Tetrahydro-4-phenyl-2H-pyran-4-methanol

Description:
Tetrahydro-4-phenyl-2H-pyran-4-methanol, identified by its CAS number 930111-15-2, is an organic compound characterized by its unique bicyclic structure, which includes a pyran ring fused with a phenyl group. This compound typically exhibits properties associated with both alcohols and cyclic ethers, including moderate polarity due to the hydroxyl (-OH) group. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly as a building block for more complex molecules. The presence of the phenyl group may impart aromatic characteristics, influencing its reactivity and interactions with other chemical species. Additionally, the compound's stereochemistry can affect its biological activity and solubility. While specific physical properties such as boiling point, melting point, and solubility can vary, they are generally influenced by the compound's functional groups and overall molecular architecture. As with many organic compounds, safety data and handling precautions should be considered when working with Tetrahydro-4-phenyl-2H-pyran-4-methanol in a laboratory setting.
Formula:C12H16O2
InChI:InChI=1S/C12H16O2/c13-10-12(6-8-14-9-7-12)11-4-2-1-3-5-11/h1-5,13H,6-10H2
InChI key:InChIKey=OHKBZOSLGDHFQS-UHFFFAOYSA-N
SMILES:C(O)C1(CCOCC1)C2=CC=CC=C2
Synonyms:
  • Tetrahydro-4-phenyl-2H-pyran-4-methanol
  • 2H-Pyran-4-methanol, tetrahydro-4-phenyl-
Found 1 products.