CymitQuimica logo

CAS 93023-72-4

:

4-Morpholineacetamide, N-[4-(4-methylphenyl)-2-thiazolyl]-

Description:
4-Morpholineacetamide, N-[4-(4-methylphenyl)-2-thiazolyl]- is a chemical compound characterized by its unique structural features, which include a morpholine ring and a thiazole moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity. The presence of the thiazole and aromatic groups may contribute to its reactivity and interaction with biological systems, making it of interest in pharmaceutical research. The morpholine ring can enhance the compound's ability to form hydrogen bonds, influencing its pharmacokinetic properties. Additionally, the compound may exhibit specific melting and boiling points, as well as stability under standard laboratory conditions. Its CAS number, 93023-72-4, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C16H19N3O2S
InChI:InChI=1S/C16H19N3O2S/c1-12-2-4-13(5-3-12)14-11-22-16(17-14)18-15(20)10-19-6-8-21-9-7-19/h2-5,11H,6-10H2,1H3,(H,17,18,20)
InChI key:OXVHUCBDTYJZKC-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)CN3CCOCC3
Synonyms:
  • 4-Morpholineacetamide, N-[4-(4-methylphenyl)-2-thiazolyl]-
  • WAY-605925
  • 2-Morpholino-N-(4-(p-tolyl)thiazol-2-yl)acetamide
Found 3 products.