CymitQuimica logo

CAS 93033-58-0

:

Benzaldehyde, 3-(phenylmethoxy)-, oxime

Description:
Benzaldehyde, 3-(phenylmethoxy)-, oxime, with the CAS number 93033-58-0, is an organic compound characterized by its oxime functional group, which is derived from benzaldehyde. This compound features a phenylmethoxy group, indicating the presence of a methoxy group attached to a phenyl ring, contributing to its unique chemical properties. Typically, oximes are known for their ability to form stable complexes with metal ions and can participate in various chemical reactions, including condensation and rearrangement reactions. The presence of the aromatic rings in this compound enhances its stability and may influence its solubility in organic solvents. Benzaldehyde derivatives often exhibit applications in organic synthesis, fragrance formulations, and as intermediates in the production of pharmaceuticals. Additionally, the compound may display specific reactivity patterns due to the electron-donating and withdrawing effects of the substituents on the aromatic rings. Overall, Benzaldehyde, 3-(phenylmethoxy)-, oxime is a notable compound in organic chemistry with potential applications in various fields.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c16-15-10-13-7-4-8-14(9-13)17-11-12-5-2-1-3-6-12/h1-10,16H,11H2/b15-10+
InChI key:YUQATBOXIFGNQR-XNTDXEJSSA-N
SMILES:C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=N/O
Found 2 products.