CymitQuimica logo

CAS 930396-14-8

:

8-Bromo-5-quinolinesulfonyl chloride

Description:
8-Bromo-5-quinolinesulfonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a bromine atom and a sulfonyl chloride functional group. This compound typically appears as a solid or crystalline substance and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. The bromine atom in its structure can also serve as a site for further functionalization, making it a versatile intermediate in synthetic chemistry. Additionally, 8-Bromo-5-quinolinesulfonyl chloride may exhibit biological activity, which can be explored in medicinal chemistry contexts. As with many sulfonyl chlorides, it should be handled with care due to its potential to release hydrochloric acid upon reaction with water or alcohols.
Formula:C9H5BrClNO2S
InChI:InChI=1S/C9H5BrClNO2S/c10-7-3-4-8(15(11,13)14)6-2-1-5-12-9(6)7/h1-5H
InChI key:InChIKey=VBWUIBNELGOUJQ-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C2=C(C(Br)=CC1)N=CC=C2
Synonyms:
  • 8-Bromo-5-quinolinesulfonyl chloride
  • 5-Quinolinesulfonyl chloride, 8-bromo-
  • 8-bromoquinoline-5-sulfonyl chloride
Found 1 products.