CymitQuimica logo

CAS 930596-20-6

:

N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-Pyrazole-1-acetamide

Description:
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-acetamide is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a dioxaborolane moiety. The presence of the dimethyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. The dioxaborolane group is known for its ability to form stable complexes with various substrates, making this compound of interest in medicinal chemistry and materials science. It may exhibit properties such as moderate to high stability under standard conditions, and its reactivity can be influenced by the presence of the boron atom, which can participate in various chemical reactions, including nucleophilic attacks. This compound may also be evaluated for its potential applications in drug development, particularly in targeting specific biological pathways due to the pyrazole moiety, which is often associated with pharmacological activity. Overall, its structural features suggest a versatile compound with potential utility in various chemical and biological contexts.
Formula:C13H22BN3O3
InChI:InChI=1S/C13H22BN3O3/c1-12(2)13(3,4)20-14(19-12)10-7-15-17(8-10)9-11(18)16(5)6/h7-8H,9H2,1-6H3
InChI key:RVZZYZZVSAPLOO-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(=O)N(C)C
Found 6 products.