CymitQuimica logo

CAS 93071-65-9

:

Methyl 3-(aminomethyl)benzoate

Description:
Methyl 3-(aminomethyl)benzoate, with the CAS number 93071-65-9, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which is further substituted with an aminomethyl group at the meta position. This structure imparts both hydrophilic and lipophilic characteristics, making it soluble in various organic solvents while having some degree of water solubility. The presence of the amino group allows for potential reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Methyl 3-(aminomethyl)benzoate may exhibit biological activity, which could be of interest in pharmaceutical applications. Its physical properties, such as melting point, boiling point, and density, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment to avoid inhalation or skin contact.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-5H,6,10H2,1H3
InChI key:OWBKDJSKHXGOJY-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=CC(=C1)CN
Synonyms:
  • 3-(Aminomethyl)benzoic acid methyl ester
Found 4 products.