CymitQuimica logo

CAS 930800-38-7

:

N-Hex-5-ynyl-2-iodo-acetamide

Description:
N-Hex-5-ynyl-2-iodo-acetamide is an organic compound characterized by its unique structure, which includes a terminal alkyne group (hex-5-ynyl), an iodo substituent, and an acetamide functional group. The presence of the alkyne indicates that it has a triple bond between carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The iodo group enhances the compound's electrophilicity, making it useful in various chemical reactions, such as nucleophilic substitutions. The acetamide moiety provides solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential applications in materials science and as a building block in the synthesis of more complex molecules. Overall, N-Hex-5-ynyl-2-iodo-acetamide is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C8H12INO
InChI:InChI=1S/C8H12INO/c1-2-3-4-5-6-10-8(11)7-9/h1H,3-7H2,(H,10,11)
InChI key:YCRUVTMZPHEOAM-UHFFFAOYSA-N
SMILES:C#CCCCCNC(=O)CI
Synonyms:
  • IA-Alkyne
  • Acetamide, N-5-hexyn-1-yl-2-iodo-
  • N-Hex-5-ynyl-2-iodo-acetamide
  • chronic bronchitis,inhibit,Transient receptor potential channels,cystic fibrosis,IA-Alkyne,bronchiectasis,obstructive,emphysema,Fluorescence,imaging,TRP Channel,chronic,asthma,IA Alkyne,cysteine,IAAlkyne,Inhibitor,gel
Found 7 products.