CymitQuimica logo

CAS 931-18-0

:

1,4-Dihydro-2,3-pyrazinedione

Description:
1,4-Dihydro-2,3-pyrazinedione, also known as 2,3-pyrazinedione, is a heterocyclic organic compound characterized by a pyrazine ring with two carbonyl groups. Its molecular structure features a six-membered ring containing two nitrogen atoms, contributing to its unique chemical properties. This compound is typically a white to light yellow crystalline solid and is soluble in polar solvents such as water and alcohols. It exhibits tautomerism, existing in equilibrium between its keto and enol forms, which can influence its reactivity and interactions. 1,4-Dihydro-2,3-pyrazinedione is known for its potential applications in pharmaceuticals and agrochemicals, particularly due to its ability to act as a building block in the synthesis of various bioactive compounds. Additionally, it may exhibit biological activities, including antimicrobial and antioxidant properties, making it of interest in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety protocols to minimize exposure.
Formula:C4H4N2O2
InChI:InChI=1S/C4H4N2O2/c7-3-4(8)6-2-1-5-3/h1-2H,(H,5,7)(H,6,8)
InChI key:InChIKey=CIGLZLCKRXOFQU-UHFFFAOYSA-N
SMILES:O=C1C(=O)NC=CN1
Synonyms:
  • 2,3-Pyrazinediol
  • 2,3-Pyrazinedione, 1,4-dihydro-
  • 2,3-Dihydroxypyrazine
  • 1,4-Dihydro-2,3-pyrazinedione
Found 5 products.