CAS 931706-15-9
:PPQ-102
Description:
PPQ-102, identified by its CAS number 931706-15-9, is a chemical compound that has garnered interest in various fields, particularly in medicinal chemistry and pharmacology. It is characterized by its specific molecular structure, which contributes to its biological activity. PPQ-102 is known to interact with certain biological targets, potentially influencing pathways related to neurological functions. The compound may exhibit properties such as solubility in organic solvents and stability under standard laboratory conditions, although specific solubility and stability data would depend on the experimental context. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its purity and identity. As with many compounds in research, understanding its pharmacokinetics and pharmacodynamics is crucial for evaluating its potential therapeutic applications. Safety and handling precautions are essential when working with PPQ-102, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C26H22N4O3
InChI:InChI=1S/C26H22N4O3/c1-15-13-14-19(33-15)21-24-23-20(25(31)29(3)26(32)28(23)2)22(16-9-5-4-6-10-16)30(24)18-12-8-7-11-17(18)27-21/h4-14,21,27H,1-3H3
InChI key:MNOOVRNGPIWJDI-UHFFFAOYSA-N
SMILES:CC1=CC=C(O1)C2C3=C4C(=C(N3C5=CC=CC=C5N2)C6=CC=CC=C6)C(=O)N(C(=O)N4C)C
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
7,9-Dimethyl-6-(5-Methylfuran-2-Yl)-11-Phenyl-6,7-Dihydropyrimido[4',5':3,4]Pyrrolo[1,2-A]Quinoxaline-8,10(5H,9H)-Dione
CAS:7,9-Dimethyl-6-(5-Methylfuran-2-Yl)-11-Phenyl-6,7-Dihydropyrimido[4',5':3,4]Pyrrolo[1,2-A]Quinoxaline-8,10(5H,9H)-DioneFormula:C26H22N4O3Purity:99%Molecular weight:438.48PPQ-102
CAS:PPQ-102 (CFTR Inhibitor), an effective CFTR inhibitor, can completely inhibit CFTR chloride current (IC50: 90 nM).Formula:C26H22N4O3Purity:98.80% - ≥95%Color and Shape:Yellow SolidMolecular weight:438.4779PPQ-102
CAS:7,9-Dimethyl-6-(5-methylfuran-2-yl)-11-phenyl-6,7-dihydropyrimido[4',5':3,4]pyrrolo[1,2-a]quinoxaline-8,10(5H,9H)-dioneFormula:C26H22N4O3Purity:99%Molecular weight:438.48CFTR Inhibitor IV, PPQ-102
CAS:PPQ-102 is a chloride channel blocker that inhibits the CFTR protein in the cell membrane. PPQ-102 does not bind to other proteins in the cell and is selective for CFTR. It has been shown to inhibit natural compounds, such as epidermal growth factor, from binding to CFTR. As a result, there is less cellular uptake of epidermal growth factor, which leads to lower levels of epidermal growth factor and subsequently lower rates of tumor growth. PPQ-102 also blocks the uptake of chloride ions by cells and has anti-inflammatory effects.Formula:C26H22N4O3Purity:Min. 95%Molecular weight:438.48 g/mol
