CAS 93176-00-2
:3-hydroxy-6-methoxyflavone
Description:
3-Hydroxy-6-methoxyflavone, identified by its CAS number 93176-00-2, is a flavonoid compound characterized by its structural features that include a hydroxyl group (-OH) at the 3-position and a methoxy group (-OCH3) at the 6-position of the flavone backbone. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems that allow for light absorption. It is known for its potential antioxidant properties, which can help in scavenging free radicals and may contribute to various health benefits. Additionally, flavonoids like 3-hydroxy-6-methoxyflavone are often studied for their anti-inflammatory, antimicrobial, and anticancer activities. The solubility of this compound can vary depending on the solvent, but it is generally more soluble in organic solvents than in water. Its applications may extend to food, pharmaceuticals, and cosmetics, where it can serve as a natural colorant or functional ingredient.
Formula:C16H12O4
InChI:InChI=1/C16H12O4/c1-19-11-7-8-13-12(9-11)14(17)15(18)16(20-13)10-5-3-2-4-6-10/h2-9,18H,1H3
InChI key:OGURJSOPVFCIOO-UHFFFAOYSA-N
SMILES:COc1ccc2c(c1)c(=O)c(c(c1ccccc1)o2)O
Synonyms:- 3-hydroxy-6-methoxy-2-phenyl-4H-chromen-4-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Hydroxy-6-methoxyflavone
CAS:Formula:C16H12O4Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:268.273-Hydroxy-6-methoxyflavone
CAS:3-Hydroxy-6-methoxyflavoneFormula:C16H12O4Purity:≥98%Molecular weight:268.263-Hydroxy-6-methoxyflavone
CAS:3-Hydroxy-6-methoxyflavone can be used in combination with antibiotics to treat ESKAPE pathogen infections.Formula:C16H12O4Purity:99.97%Color and Shape:SolidMolecular weight:268.26413-Hydroxy-6-Methoxyflavone
CAS:3-Hydroxy-6-MethoxyflavoneFormula:C16H12O4Purity:98%Molecular weight:268.273-Hydroxy-6-methoxy-2-phenyl-4H-chromen-4-one
CAS:Formula:C16H12O4Purity:98%Color and Shape:SolidMolecular weight:268.26416-Methoxyflavonol
CAS:6-Methoxyflavonol is a flavonoid compound, which is a type of polyphenolic substance commonly found in various plants. It is derived from natural sources such as fruits, vegetables, and certain herbs. Flavonoids like 6-Methoxyflavonol are known for their diverse biological activities, largely attributed to their antioxidant properties. The compound acts as an antioxidant by neutralizing free radicals, which helps to protect cells from oxidative stress and potential damage.
Formula:C16H12O4Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:268.26 g/mol
