CymitQuimica logo

CAS 931930-84-6

:

5-(4-methylpiperazin-1-yl)pentanoic acid

Description:
5-(4-Methylpiperazin-1-yl)pentanoic acid is an organic compound characterized by its structure, which includes a pentanoic acid chain and a 4-methylpiperazine moiety. This compound features a carboxylic acid functional group, which imparts acidic properties, and a piperazine ring that contributes to its potential biological activity. The presence of the methyl group on the piperazine enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit various interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for hydrogen bonding and other intermolecular interactions, which can affect solubility and reactivity. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 5-(4-methylpiperazin-1-yl)pentanoic acid represents a versatile scaffold for further chemical modifications and applications in drug design.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-11-6-8-12(9-7-11)5-3-2-4-10(13)14/h2-9H2,1H3,(H,13,14)
InChI key:AROMGYXEPCNUQL-UHFFFAOYSA-N
SMILES:CN1CCN(CC1)CCCCC(=O)O
Synonyms:
  • 5-(4-methylpiperazin-1-yl)pentanoic acid
  • 1-Piperazinepentanoic acid, 4-methyl-
  • 4-Methyl-1-piperazinepentanoic acid
Found 2 products.