CymitQuimica logo

CAS 932-41-2

:

2,3-thiophenedicarboxaldehyde

Description:
2,3-Thiophenedicarboxaldehyde, with the CAS number 932-41-2, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features two aldehyde functional groups (-CHO) located at the 2 and 3 positions of the thiophene ring, making it a dicarboxaldehyde. It typically appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. The presence of the aldehyde groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. 2,3-Thiophenedicarboxaldehyde is of interest in organic synthesis and materials science, particularly in the development of functionalized polymers and as a building block for more complex molecules. Its unique electronic properties, derived from the thiophene structure, make it suitable for applications in organic electronics and as a precursor in the synthesis of biologically active compounds. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H4O2S
InChI:InChI=1/C6H4O2S/c7-3-5-1-2-9-6(5)4-8/h1-4H
InChI key:WSEJZRIZDQWMKQ-UHFFFAOYSA-N
SMILES:c1csc(C=O)c1C=O
Synonyms:
  • Thiophene-2,3-Dicarbaldehyde
Found 5 products.