CymitQuimica logo

CAS 932-77-4

:

3-Bromobenzyl chloride

Description:
3-Bromobenzyl chloride, with the CAS number 932-77-4, is an organic compound characterized by the presence of both a bromine atom and a chloromethyl group attached to a benzene ring. It is a colorless to pale yellow liquid at room temperature and has a distinctive aromatic odor. The compound is classified as an alkyl halide and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the electrophilic carbon in the chloromethyl group. Its molecular structure features a bromine atom positioned at the meta position relative to the chloromethyl group on the benzene ring, which influences its chemical behavior and reactivity. 3-Bromobenzyl chloride is soluble in organic solvents such as ether and chloroform but has limited solubility in water. It is used in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. As with many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C7H6BrCl
InChI:InChI=1/C7H6BrCl/c8-7-3-1-2-6(4-7)5-9/h1-4H,5H2
InChI key:UDKGXKYEWBGQCG-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)Br)CCl
Synonyms:
  • 3-Bromo-alpha-chlorotoluene
  • 1-Bromo-3-(Chloromethyl)Benzene
Found 5 products.