CymitQuimica logo

CAS 932041-14-0

:

Methyl 4-chloro-1H-indazole-3-carboxylate

Description:
Methyl 4-chloro-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and a carboxylate group at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a white to off-white solid and is soluble in organic solvents such as methanol and dimethyl sulfoxide (DMSO). Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's properties, including its melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Methyl 4-chloro-1H-indazole-3-carboxylate is of interest in research due to its potential biological activities, including anti-inflammatory and anticancer properties, although specific biological data may require further investigation. As with all chemical substances, proper handling and safety precautions should be observed when working with this compound.
Formula:C9H7ClN2O2
InChI:InChI=1S/C9H7ClN2O2/c1-14-9(13)8-7-5(10)3-2-4-6(7)11-12-8/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=ZTEHEVOAKFIDDI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NN1)=CC=CC2Cl
Synonyms:
  • Methyl 4-chloro-1H-indazole-3-carboxylate
  • 1H-Indazole-3-carboxylic acid, 4-chloro-, methyl ester
Found 3 products.