CymitQuimica logo

CAS 93209-97-3

:

2-Thiazolamine, 4-(2,4-dichlorophenyl)-

Description:
2-Thiazolamine, 4-(2,4-dichlorophenyl)-, identified by its CAS number 93209-97-3, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a dichlorophenyl group, which contributes to its potential biological activity and chemical reactivity. The dichlorophenyl moiety typically enhances lipophilicity and may influence the compound's interaction with biological targets. 2-Thiazolamine derivatives are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The presence of the thiazolamine functional group suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic ring and the thiazole structure. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C9H6Cl2N2S
InChI:InChI=1/C9H6Cl2N2S/c10-5-1-2-6(7(11)3-5)8-4-14-9(12)13-8/h1-4H,(H2,12,13)
InChI key:APJACVDBTHESJL-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)Cl)c1csc(=N)[nH]1
Synonyms:
  • 4-(2,4-Dichlorophenyl)-1,3-Thiazol-2-Amine
Found 4 products.