CymitQuimica logo

CAS 93249-44-6

:

2-Fluoro-5-methylbenzaldehyde

Description:
2-Fluoro-5-methylbenzaldehyde is an aromatic aldehyde characterized by the presence of a fluorine atom and a methyl group on a benzene ring, specifically at the 2 and 5 positions, respectively. This compound features a functional aldehyde group (-CHO) that contributes to its reactivity and potential applications in organic synthesis. The fluorine substituent can influence the electronic properties of the molecule, enhancing its reactivity and making it useful in various chemical reactions, including nucleophilic additions and electrophilic substitutions. The presence of the methyl group can also affect the steric and electronic environment of the molecule. 2-Fluoro-5-methylbenzaldehyde is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents and may have limited solubility in water. This compound is of interest in the field of medicinal chemistry and materials science, where it can serve as an intermediate in the synthesis of more complex organic molecules. Proper handling and storage are essential due to its potential reactivity and the presence of the fluorine atom.
Formula:C8H7FO
InChI:InChI=1/C8H7FO/c1-6-2-3-8(9)7(4-6)5-10/h2-5H,1H3
InChI key:QAWILFXCNRBMDF-UHFFFAOYSA-N
SMILES:Cc1ccc(c(c1)C=O)F
Synonyms:
  • 2-Fluor-5-methylbenzolcarbaldehyd
  • Vhr Bf E1
Found 4 products.