CymitQuimica logo

CAS 932702-13-1

:

1H-pyrazolo[3,4-c]pyridine-3-carboxylic acid

Description:
1H-pyrazolo[3,4-c]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for forming hydrogen bonds. The presence of the pyrazole ring imparts unique reactivity and biological activity, making it of interest in medicinal chemistry. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. The compound's structure allows for various substitution patterns, which can influence its pharmacological properties. It may serve as a scaffold for the development of pharmaceuticals, particularly in the fields of anti-inflammatory or anti-cancer agents. Additionally, its CAS number, 932702-13-1, allows for easy identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, 1H-pyrazolo[3,4-c]pyridine-3-carboxylic acid is a compound of significant interest in both synthetic and medicinal chemistry.
Formula:C7H5N3O2
InChI:InChI=1/C7H5N3O2/c11-7(12)6-4-1-2-8-3-5(4)9-10-6/h1-3H,(H,9,10)(H,11,12)
InChI key:QDZQGBUZFAVGIW-UHFFFAOYSA-N
SMILES:c1cncc2c1c(C(=O)O)[nH]n2
Found 2 products.