CymitQuimica logo

CAS 932710-61-7

:

4-Bromo-α-(trifluoromethyl)benzenebutanoic acid

Description:
4-Bromo-α-(trifluoromethyl)benzenebutanoic acid is an organic compound characterized by its unique functional groups and structural features. It contains a bromine atom and a trifluoromethyl group attached to a benzene ring, which contributes to its chemical reactivity and physical properties. The presence of the butanoic acid moiety indicates that it has a carboxylic acid functional group, making it acidic in nature. This compound is likely to exhibit hydrophobic characteristics due to the aromatic and trifluoromethyl groups, while the carboxylic acid group can engage in hydrogen bonding, influencing its solubility in various solvents. The trifluoromethyl group is known for enhancing the lipophilicity and metabolic stability of compounds, which can be beneficial in pharmaceutical applications. Additionally, the bromine substituent may impart unique electronic properties, affecting the compound's reactivity and interactions with biological targets. Overall, 4-Bromo-α-(trifluoromethyl)benzenebutanoic acid is a compound of interest in medicinal chemistry and materials science due to its distinctive structural attributes.
Formula:C11H10BrF3O2
InChI:InChI=1S/C11H10BrF3O2/c12-8-4-1-7(2-5-8)3-6-9(10(16)17)11(13,14)15/h1-2,4-5,9H,3,6H2,(H,16,17)
InChI key:InChIKey=PCMHAMVZYDCSMG-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Br)C=C1)(C(F)(F)F)C(O)=O
Synonyms:
  • Benzenebutanoic acid, 4-bromo-α-(trifluoromethyl)-
  • 4-Bromo-α-(trifluoromethyl)benzenebutanoic acid
Found 1 products.