CymitQuimica logo

CAS 932854-92-7

:

5-(morpholinomethyl)furan-3-carboxylic acid

Description:
5-(Morpholinomethyl)furan-3-carboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a morpholinomethyl group indicates that the compound has a morpholine moiety, a six-membered ring containing both oxygen and nitrogen, attached to the furan via a methylene bridge. This structure contributes to its potential as a bioactive molecule, possibly influencing its solubility and reactivity. The carboxylic acid functional group at the 3-position of the furan ring provides acidic properties, allowing for hydrogen bonding and interactions with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its unique combination of functional groups suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental conditions and the presence of other chemical entities.
Formula:C10H13NO4
InChI:InChI=1/C10H13NO4/c12-10(13)8-5-9(15-7-8)6-11-1-3-14-4-2-11/h5,7H,1-4,6H2,(H,12,13)
SMILES:C1COCCN1Cc1cc(co1)C(=O)O
Synonyms:
  • 3-Furancarboxylic Acid, 5-(4-Morpholinylmethyl)-
  • 5-(Morpholin-4-Ylmethyl)Furan-3-Carboxylic Acid
Found 1 products.