
CAS 933442-47-8
:2-Propanol, 1-[[2-(2-methoxyphenoxy)ethyl]amino]-3-[(9-methyl-9H-carbazol-4-yl)oxy]-
Description:
2-Propanol, 1-[[2-(2-methoxyphenoxy)ethyl]amino]-3-[(9-methyl-9H-carbazol-4-yl)oxy]- is a complex organic compound characterized by its multi-functional structure, which includes an isopropanol moiety, an ether linkage, and an amine group. This compound features a carbazole derivative, which contributes to its potential biological activity and photophysical properties. The presence of the methoxyphenoxy group suggests potential for interactions with biological systems, possibly influencing solubility and reactivity. The compound is likely to exhibit moderate polarity due to the combination of hydrophilic (amine and ether) and hydrophobic (carbazole) components. Its molecular structure may allow for various applications in medicinal chemistry, particularly in drug design, due to the potential for specific interactions with biological targets. Additionally, the presence of multiple functional groups may facilitate diverse chemical reactivity, making it a candidate for further synthetic modifications or studies in pharmacology. Safety and handling precautions should be observed, as with any chemical substance, particularly those with complex structures.
Formula:C25H28N2O4
InChI:InChI=1S/C25H28N2O4/c1-27-20-9-4-3-8-19(20)25-21(27)10-7-13-24(25)31-17-18(28)16-26-14-15-30-23-12-6-5-11-22(23)29-2/h3-13,18,26,28H,14-17H2,1-2H3
InChI key:ZMWFMBMUJFZLJP-UHFFFAOYSA-N
SMILES:CN1C2=C(C3=CC=CC=C31)C(=CC=C2)OCC(CNCCOC4=CC=CC=C4OC)O
Synonyms:- 2-Propanol, 1-[[2-(2-methoxyphenoxy)ethyl]amino]-3-[(9-methyl-9H-carbazol-4-yl)oxy]-
- N-Methyl Carvedilol
- Carvedilol-002
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
