CymitQuimica logo

CAS 933445-54-6

:

(1S,3S)-3-Aminocyclohexanecarboxylic acid

Description:
(1S,3S)-3-Aminocyclohexanecarboxylic acid, also known as a derivative of cyclohexane, is an amino acid characterized by its cyclohexane ring structure with an amino group and a carboxylic acid functional group. This compound exhibits chirality, with specific stereochemistry at the 1 and 3 positions, which influences its biological activity and interactions. The presence of the amino group allows it to participate in various biochemical processes, making it relevant in medicinal chemistry and potential therapeutic applications. Its carboxylic acid group contributes to its acidity and solubility in polar solvents, which is important for its reactivity and interaction with other biomolecules. The compound's structural features may also influence its conformational flexibility, impacting its ability to bind to receptors or enzymes. Overall, (1S,3S)-3-Aminocyclohexanecarboxylic acid is a significant compound in the study of amino acids and their derivatives, with potential implications in drug design and development.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c8-6-3-1-2-5(4-6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6-/m0/s1
InChI key:InChIKey=CKTUXQBZPWBFDX-WDSKDSINSA-N
SMILES:C(O)(=O)[C@@H]1C[C@@H](N)CCC1
Synonyms:
  • Cyclohexanecarboxylic acid, 3-amino-, (1S,3S)-
  • (1S,3S)-3-Aminocyclohexanecarboxylic acid
Found 2 products.