CymitQuimica logo

CAS 933585-42-3

:

Ethyl 4-bromo-3-methoxybenzoate

Description:
Ethyl 4-bromo-3-methoxybenzoate is an organic compound characterized by its ester functional group, which is derived from the reaction of 4-bromo-3-methoxybenzoic acid and ethanol. This compound features a benzene ring substituted with a bromine atom at the para position and a methoxy group at the meta position relative to the ester group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. Ethyl 4-bromo-3-methoxybenzoate is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure contributes to its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the bromine and methoxy groups can influence its solubility and reactivity, making it a compound of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6H,3H2,1-2H3
InChI key:SPZBNOLKHLTDCR-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC(=C(C=C1)Br)OC
Found 3 products.