CymitQuimica logo

CAS 933585-44-5

:

Ethyl 2-iodo-5-methylbenzoate

Description:
Ethyl 2-iodo-5-methylbenzoate is an organic compound characterized by its ester functional group, derived from benzoic acid. It features an ethyl group attached to the carboxylate, a methyl group at the 5-position, and an iodine atom at the 2-position of the aromatic ring. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility and solubility in organic solvents. Ethyl 2-iodo-5-methylbenzoate is often utilized in organic synthesis, particularly in reactions involving nucleophilic substitutions due to the presence of the iodine atom, which can act as a leaving group. Its structure allows for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, it may exhibit specific reactivity patterns typical of iodo-substituted aromatic compounds, including electrophilic aromatic substitution and cross-coupling reactions. Safety precautions should be observed when handling this compound, as with many halogenated organic substances, due to potential toxicity and environmental concerns.
Formula:C10H11IO2
InChI:InChI=1S/C10H11IO2/c1-3-13-10(12)8-6-7(2)4-5-9(8)11/h4-6H,3H2,1-2H3
InChI key:InChIKey=SVWOPCVCIDLBEY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(I)C=CC(C)=C1
Synonyms:
  • Benzoic acid, 2-iodo-5-methyl-, ethyl ester
  • Ethyl 2-iodo-5-methylbenzoate
Found 4 products.