CymitQuimica logo

CAS 933671-77-3

:

3-Bromo-5-chlorobenzamide

Description:
3-Bromo-5-chlorobenzamide is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, specifically at the 3 and 5 positions, respectively. This compound features an amide functional group, which is derived from benzoic acid, where the carboxylic acid group is replaced by an amine. The presence of halogens (bromine and chlorine) can significantly influence the compound's reactivity, solubility, and biological activity. Typically, compounds like 3-bromo-5-chlorobenzamide may exhibit properties such as moderate to high polarity due to the electronegative halogens and the amide group, which can also engage in hydrogen bonding. This compound may be utilized in various chemical syntheses or as an intermediate in pharmaceutical development, given the importance of halogenated compounds in medicinal chemistry. Additionally, its unique structure may impart specific characteristics that could be explored in research related to its potential applications in agrochemicals or materials science.
Formula:C7H5BrClNO
InChI:InChI=1S/C7H5BrClNO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11)
InChI key:InChIKey=IBHVBQAJVLFFCH-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(Br)=CC(Cl)=C1
Synonyms:
  • 3-Bromo-5-chlorobenzamide
  • Benzamide, 3-bromo-5-chloro-
Found 4 products.