CymitQuimica logo

CAS 93387-82-7

:

Hydrazine, (3-iodophenyl)-, monohydrochloride

Description:
Hydrazine, (3-iodophenyl)-, monohydrochloride is a chemical compound characterized by its hydrazine functional group and an iodine substituent on the phenyl ring. It is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it easier to handle in laboratory settings. This compound is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the iodine atom can impart unique reactivity, making it useful in various chemical transformations, including nucleophilic substitutions and coupling reactions. Hydrazine derivatives are also recognized for their role as reducing agents and in the synthesis of heterocyclic compounds. However, it is important to note that hydrazine and its derivatives can be hazardous, exhibiting toxicity and potential carcinogenic properties, necessitating careful handling and appropriate safety measures in laboratory environments. As with all chemical substances, proper storage and disposal protocols should be followed to mitigate any environmental or health risks.
Formula:C6H7IN2・ClH
InChI:InChI=1S/C6H7IN2.ClH/c7-5-2-1-3-6(4-5)9-8;/h1-4,9H,8H2;1H
InChI key:BOMBFECOZPIPOX-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)I)NN.Cl
Found 3 products.