CAS 934-36-1
:1,3-benzodithiole-2-thione
Description:
1,3-Benzodithiole-2-thione, with the CAS number 934-36-1, is a heterocyclic compound characterized by its unique structure that includes a benzene ring fused to a dithiole ring. This compound features two sulfur atoms and a thione functional group, which contributes to its reactivity and potential applications in various fields. It typically appears as a solid at room temperature and is known for its distinctive odor. The presence of sulfur atoms in its structure imparts notable chemical properties, including the ability to participate in redox reactions and form coordination complexes with metals. 1,3-Benzodithiole-2-thione has been studied for its potential biological activities, including antioxidant properties and effects on cellular processes. Its derivatives may also exhibit interesting pharmacological effects, making it a subject of interest in medicinal chemistry. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings.
Formula:C7H4S3
InChI:InChI=1/C7H4S3/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H
InChI key:PTYIRFMMOVOESN-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)sc(=S)s2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2h-1,3-Benzodithiole-2-thione
CAS:2h-1,3-Benzodithiole-2-thioneFormula:C7H4S3Purity:98%Molecular weight:184.32H-1,3-Benzodithiole-2-thione
CAS:Controlled ProductApplications 2H-1,3-benzodithiole-2-thione (cas# 934-36-1) is a useful research chemical.
Formula:C7H4S3Color and Shape:NeatMolecular weight:184.32H-1,3-Benzodithiole-2-thione
CAS:2H-1,3-Benzodithiole-2-thione is a naturally occurring thiocarbamate found in urine samples of humans and Chinese medicinal herbs. It has been shown to have cancer chemopreventive effects as well as being able to inhibit the growth of human colon cancer cells in vitro. 2H-1,3-Benzodithiole-2-thione inhibits the transcriptional regulation of genes involved in cellular uptake and detoxification of xenobiotics by binding to the glutathione S transferase GSTP1. This compound also inhibits the synthesis of glucosinolates in plants, which are known for their antioxidant properties. 2H-1,3-Benzodithiole-2-thione can be synthesized from hydrogen chloride and benzyl mercaptan using an efficient method that does not require expensive reagents or solvents.Formula:C7H4S3Purity:Min. 95%Molecular weight:184.3 g/mol





