CymitQuimica logo

CAS 934-72-5

:

methyl P-tolyl sulfoxide

Description:
Methyl P-tolyl sulfoxide, with the CAS number 934-72-5, is an organosulfur compound characterized by the presence of a sulfoxide functional group attached to a methyl and a p-tolyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its polar nature, which contributes to its solubility in various organic solvents. Methyl P-tolyl sulfoxide exhibits moderate stability under standard conditions but can undergo oxidation or reduction reactions, making it useful in various synthetic applications. Its structure allows for potential interactions with biological systems, which has led to investigations into its pharmacological properties. Additionally, it is often utilized as a solvent or reagent in organic synthesis due to its ability to dissolve a wide range of compounds. Safety data indicates that, like many sulfoxides, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, methyl P-tolyl sulfoxide is a versatile compound with applications in both industrial and research settings.
Formula:C8H10OS
InChI:InChI=1S/C8H10OS/c1-7-3-5-8(6-4-7)10(2)9/h3-6H,1-2H3
InChI key:FEVALTJSQBFLEU-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)C
Synonyms:
  • Methyl 4-methylphenylsulfoxide
Found 5 products.