CymitQuimica logo

CAS 934365-16-9

:

2,1,3-Benzothiadiazole-4,7-bis(pinacolato)diboronic ester

Description:
2,1,3-Benzothiadiazole-4,7-bis(pinacolato)diboronic ester is a chemical compound characterized by its unique structure, which includes a benzothiadiazole moiety and two boronic ester groups. This compound is typically used in organic synthesis and materials science, particularly in the development of organic semiconductors and sensors due to its electronic properties. The presence of the boronic ester groups enhances its reactivity, allowing for coupling reactions, which are valuable in forming complex organic molecules. Additionally, the benzothiadiazole unit contributes to its optical properties, making it useful in applications such as fluorescence and photonic devices. The compound is generally stable under ambient conditions but may require specific handling precautions due to its reactivity. Its solubility in organic solvents facilitates its use in various synthetic protocols. Overall, 2,1,3-Benzothiadiazole-4,7-bis(pinacolato)diboronic ester is a versatile building block in the field of organic chemistry and materials science.
Formula:C18H26B2N2O4S
InChI:InChI=1S/C18H26B2N2O4S/c1-15(2)16(3,4)24-19(23-15)11-9-10-12(14-13(11)21-27-22-14)20-25-17(5,6)18(7,8)26-20/h9-10H,1-8H3
InChI key:DHWADSHFLSDMBJ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=NSN=C23)B4OC(C(O4)(C)C)(C)C
Synonyms:
  • 4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole
Found 5 products.