CAS 93457-69-3
:1-Butyl-1-methylpyrrolidinium bromide
Description:
1-Butyl-1-methylpyrrolidinium bromide is an ionic liquid that belongs to the class of pyrrolidinium-based salts. It is characterized by its low volatility, high thermal stability, and good solubility in various solvents, making it suitable for a range of applications, including as a solvent in chemical reactions and as an electrolyte in electrochemical devices. The structure features a pyrrolidinium cation with a butyl and a methyl group, contributing to its unique properties. This compound typically exhibits a relatively low melting point compared to traditional salts, allowing it to remain in a liquid state at room temperature. Its bromide anion provides ionic conductivity, which is beneficial for applications in batteries and fuel cells. Additionally, 1-butyl-1-methylpyrrolidinium bromide is often studied for its potential in green chemistry due to its reduced environmental impact compared to conventional organic solvents. Overall, its combination of ionic characteristics and favorable physical properties makes it a subject of interest in both academic and industrial research.
Formula:C9H20N·Br
InChI:InChI=1S/C9H20N.BrH/c1-3-4-7-10(2)8-5-6-9-10;/h3-9H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=LCZRPQGSMFXSTC-UHFFFAOYSA-M
SMILES:C(CCC)[N+]1(C)CCCC1.[Br-]
Synonyms:- N-butyl-N-methylpyrrolidinium bromide
- N-methyl-N-butylpyrrolidinium bromide
- Pyrrolidinium, 1-Butyl-1-Methyl-, Bromide (1:1)
- Pyrrolidinium, 1-butyl-1-methyl-, bromide
- 1-Butyl-1-methylpyrrolidinium Bromide
- 1-Butyl-1-methylpyrrolidinium bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Butyl-1-methylpyrrolidinium Bromide
CAS:Formula:C9H20BrNPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:222.17Pyrrolidinium, 1-butyl-1-methyl-, bromide (1:1)
CAS:Formula:C9H20BrNPurity:97%Color and Shape:SolidMolecular weight:222.16581-Butyl-1-methylpyrrolidinium Bromide
CAS:1-Butyl-1-methylpyrrolidinium BromideFormula:C9H20BrNPurity:97%Molecular weight:222.17N-butyl-N-methylpyrrolidinium bromide
CAS:Formula:C9H20BrNPurity:97%Color and Shape:Liquid, No data available.Molecular weight:222.171-Butyl-1-methylpyrrolidinium bromide
CAS:1-Butyl-1-methylpyrrolidinium bromide is a pyridinium salt with a pyrrolidinium moiety. It forms by the reaction of 1-butylpiperidine and 2 equivalents of Br2 in dichloromethane at -20 degrees Celsius. The formation rate can be determined by measuring the absorbance of the product at 227 nm. 1-Butyl-1-methylpyrrolidinium bromide is an analytical reagent that has been used to determine the viscosity and pH of organic solutions, as well as enzyme activities and kinetic parameters. It has also been used for chemical structures and chromatographic science studies, such as electrochemical impedance spectroscopy.Formula:C9H20BrNPurity:Min. 95%Color and Shape:White PowderMolecular weight:222.17 g/mol




