CymitQuimica logo

CAS 934591-79-4

:

Methyl 5-N,4-O-Carbonyl-3,5-dideoxy-2-S-phenyl-2-thio-D-glycero-beta-D-galacto-2-nonulopyranosylonate

Description:
Methyl 5-N,4-O-Carbonyl-3,5-dideoxy-2-S-phenyl-2-thio-D-glycero-beta-D-galacto-2-nonulopyranosylonate, with the CAS number 934591-79-4, is a complex organic compound characterized by its unique structural features, including multiple functional groups such as carbonyl, thio, and various sugar moieties. This compound belongs to the class of glycosides and is likely to exhibit specific stereochemistry due to the presence of chiral centers in its structure. The thioether functionality suggests potential reactivity in nucleophilic substitution reactions, while the carbonyl group may participate in condensation or addition reactions. Its methyl ester form indicates that it may be more soluble in organic solvents, which can influence its biological activity and interactions. The presence of phenyl groups may enhance lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound's intricate structure suggests it may have applications in medicinal chemistry or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C17H21NO8S
InChI:InChI=1S/C17H21NO8S/c1-24-15(22)17(27-9-5-3-2-4-6-9)7-11-12(18-16(23)25-11)14(26-17)13(21)10(20)8-19/h2-6,10-14,19-21H,7-8H2,1H3,(H,18,23)/t10-,11+,12-,13-,14-,17-/m1/s1
InChI key:PWTWMNLOCAQKPJ-NPPSNJSXSA-N
SMILES:COC(=O)[C@@]1(C[C@H]2[C@H]([C@@H](O1)[C@@H]([C@@H](CO)O)O)NC(=O)O2)SC3=CC=CC=C3
Found 2 products.