CymitQuimica logo

CAS 934665-46-0

:

1-Azetidinecarboxylic acid, 3-ethylidene-, 1,1-diMethylethyl ester

Description:
1-Azetidinecarboxylic acid, 3-ethylidene-, 1,1-dimethylethyl ester, identified by the CAS number 934665-46-0, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered nitrogen-containing heterocycle, contributing to its reactivity and potential biological activity. The presence of the ethylidene group and the tert-butyl ester moiety enhances its lipophilicity, which may influence its solubility and permeability in biological systems. This compound is likely to exhibit properties typical of esters, such as being relatively stable under neutral conditions but susceptible to hydrolysis in the presence of acids or bases. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the azetidine ring may impart specific stereochemical properties, which could be relevant in the context of drug design and interaction with biological targets. Overall, this compound's unique characteristics make it a subject of interest for further research and application in various chemical fields.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c1-5-8-6-11(7-8)9(12)13-10(2,3)4/h5H,6-7H2,1-4H3
InChI key:BBIQBESQCNUEAJ-UHFFFAOYSA-N
SMILES:CC=C1CN(C1)C(=O)OC(C)(C)C
Synonyms:
  • tert-butyl 3-ethylideneazetidine-1-carboxylate
  • 1-Boc-3-ethylideneazetidine
  • 1-Azetidinecarboxylic acid, 3-ethylidene-, 1,1-diMethylethyl ester
Found 3 products.