CymitQuimica logo

CAS 934987-26-5

:

2-Bromo-3,6-difluorobenzaldehyde

Description:
2-Bromo-3,6-difluorobenzaldehyde is an aromatic compound characterized by the presence of a benzaldehyde functional group, which features a carbonyl group (C=O) directly attached to a benzene ring. This compound contains two fluorine atoms and one bromine atom substituted on the benzene ring, specifically at the 3 and 6 positions relative to the aldehyde group, and a bromine atom at the 2 position. The presence of these halogen substituents significantly influences the compound's reactivity and physical properties, such as its boiling and melting points, solubility, and polarity. Generally, halogenated aromatic compounds exhibit unique electronic properties due to the electronegative nature of halogens, which can affect their behavior in chemical reactions, including electrophilic aromatic substitution. 2-Bromo-3,6-difluorobenzaldehyde may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be observed when handling this compound due to the potential hazards associated with halogenated organic substances.
Formula:C7H3BrF2O
InChI:InChI=1S/C7H3BrF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H
InChI key:PQXMBFZKKQNHBA-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1F)C=O)Br)F
Found 3 products.