CymitQuimica logo

CAS 93601-68-4

:

D-Galactose, 2-O-a-D-galactopyranosyl-

Description:
D-Galactose, 2-O-α-D-galactopyranosyl- (CAS 93601-68-4) is a disaccharide composed of two galactose units linked by a glycosidic bond. This compound is characterized by its sweet taste and is soluble in water, making it relevant in various biological and industrial applications. It is a reducing sugar, which means it can participate in redox reactions, particularly in the presence of oxidizing agents. The structure features a pyranose ring, which is a six-membered cyclic form of galactose, and the α configuration indicates the orientation of the hydroxyl group at the anomeric carbon. D-Galactose is naturally occurring and is found in lactose, the sugar present in milk, and plays a crucial role in cellular metabolism and energy production. Its derivatives and oligosaccharides are significant in the study of glycoproteins and glycolipids, contributing to cell recognition and signaling processes. Overall, D-Galactose, 2-O-α-D-galactopyranosyl- is an important carbohydrate with diverse biological functions and applications.
Formula:C12H22O11
InChI:InChI=1S/C12H22O11/c13-1-3-6(16)8(18)10(11(20)21-3)23-12-9(19)7(17)5(15)4(2-14)22-12/h3-20H,1-2H2
InChI key:HIWPGCMGAMJNRG-UHFFFAOYSA-N
SMILES:C(C1C(C(C(C(O1)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O
Found 5 products.