CymitQuimica logo

CAS 936250-22-5

:

(2-Aminopyrimidin-5-yl)boronic acid

Description:
(2-Aminopyrimidin-5-yl)boronic acid is an organic compound characterized by the presence of both a pyrimidine ring and a boronic acid functional group. The pyrimidine moiety contributes to its aromatic properties, while the boronic acid group is known for its ability to form reversible covalent bonds with diols, making it valuable in various chemical reactions, including Suzuki coupling. This compound typically exhibits moderate solubility in polar solvents, such as water and alcohols, due to the presence of the amino and boronic acid groups, which can engage in hydrogen bonding. Its structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, (2-Aminopyrimidin-5-yl)boronic acid may serve as a building block in organic synthesis, facilitating the construction of more complex molecular architectures. As with many boronic acids, it is important to handle this compound with care, as it can be sensitive to moisture and air, which may affect its stability and reactivity.
Formula:C4H6BN3O2
InChI:InChI=1S/C4H6BN3O2/c6-4-7-1-3(2-8-4)5(9)10/h1-2,9-10H,(H2,6,7,8)
InChI key:InChIKey=CGHYQZASLKERLV-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=NC(N)=NC1
Synonyms:
  • (2-Aminopyrimidin-5-yl)boronic acid
  • 2-Amino-pyrimidine-5-boronic acid
  • 2-Aminopyrimidine-5-boronic acid
  • 2-Aminopyrimidine-5-boronicacid
  • B-(2-Amino-5-pyrimidinyl)boronic acid
  • boronic acid, B-(2-amino-5-pyrimidinyl)-
Found 7 products.