CymitQuimica logo

CAS 936368-68-2

:

4-(4-chloropyridin-2-yl)piperazine-1-carboxylic acid tert-butyl ester

Description:
4-(4-chloropyridin-2-yl)piperazine-1-carboxylic acid tert-butyl ester is a chemical compound characterized by its complex structure, which includes a piperazine ring, a chloropyridine moiety, and a tert-butyl ester functional group. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the piperazine and carboxylic acid groups. It is likely to be a white to off-white solid at room temperature and may be soluble in organic solvents such as methanol or dimethyl sulfoxide, while showing limited solubility in water. The presence of the chloropyridine group may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the tert-butyl ester can influence the compound's lipophilicity and stability, affecting its pharmacokinetic properties. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting various biological pathways.
Formula:C14H20ClN3O2
InChI:InChI=1S/C14H20ClN3O2/c1-14(2,3)20-13(19)18-8-6-17(7-9-18)12-10-11(15)4-5-16-12/h4-5,10H,6-9H2,1-3H3
InChI key:PROPFBXURCWWDT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=CC(=C2)Cl
Found 2 products.