CAS 936947-34-1

1-oxa-6-azaspiro[3.3]heptane hemioxalate

Description:

1-Oxa-6-azaspiro[3.3]heptane hemioxalate is a chemical compound characterized by its unique spirocyclic structure, which includes both an oxygen and a nitrogen atom within its framework. The presence of the oxalate moiety indicates that it forms a salt or ester with oxalic acid, contributing to its potential solubility and reactivity. This compound may exhibit interesting properties such as chirality due to its spiro configuration, which can influence its biological activity and interactions. The nitrogen atom in the structure suggests potential basicity, while the oxygen atom may participate in hydrogen bonding, affecting its physical properties like melting point and solubility. Additionally, the hemioxalate form implies that it may exist in a hydrated state or have specific stoichiometric relationships with oxalic acid. Overall, 1-oxa-6-azaspiro[3.3]heptane hemioxalate is likely to be of interest in medicinal chemistry and materials science due to its structural complexity and potential applications.

Formula: C5H9NO

InChI: InChI=1S/C5H9NO/c1-2-7-5(1)3-6-4-5/h6H,1-4H2

InChI key: ZPJGOWOMUISLPL-UHFFFAOYSA-N

SMILES: C1COC12CNC2

1-Oxa-6-azaspiro[3.3]heptane oxalate

CAS: 936947-34-1

1-Oxa-6-azaspiro[3.3]heptane oxalate

Formula: C₅H₉NO·C₂H₂O₄

Purity: 98%

Molecular weight: 189.16594

Ref: 54-OR317044

1-Oxa-6-azaspiro[3.3]heptane oxalate

CAS: 936947-34-1

1-Oxa-6-azaspiro[3.3]heptane

Formula: C₅H₉NO

Purity: 98%

Molecular weight: 99.13

Ref: IN-DG224702

1-Oxa-6-azaspiro[3.3]heptane

CAS: 936947-34-1

Purity: 98+%

Color and Shape: Solid

Molecular weight: 99.13300323

Ref: 10-F624691

1-Oxa-6-azaspiro[3.3]heptane

CAS: 936947-34-1

Formula: C₅H₉NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 99.1311

Ref: IN-DA006EN6