CymitQuimica logo

CAS 937049-27-9

:

4-Amino-pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile

Description:
4-Amino-pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile is a heterocyclic compound characterized by its complex ring structure, which includes a pyrrole and triazine moiety. This compound features an amino group and a cyano group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile, while the cyano group can enhance its electronic properties and solubility in polar solvents. The unique structural arrangement of the fused rings provides a platform for diverse chemical modifications, making it a candidate for further research in medicinal chemistry. Additionally, its CAS number, 937049-27-9, allows for easy identification and retrieval of information regarding its properties, synthesis, and potential uses. Overall, this compound exemplifies the rich chemistry associated with nitrogen-containing heterocycles, which are often integral to biologically active molecules.
Formula:C7H5N5
InChI:InChI=1S/C7H5N5/c8-2-5-1-6-7(9)10-4-11-12(6)3-5/h1,3-4H,(H2,9,10,11)
InChI key:YCOWMCJDHVVWKJ-UHFFFAOYSA-N
SMILES:C1=C2C(=NC=NN2C=C1C#N)N
Found 3 products.