CymitQuimica logo

CAS 937601-79-1

:

1-(2-Cyanophenyl)-4-piperidinecarboxylic acid

Description:
1-(2-Cyanophenyl)-4-piperidinecarboxylic acid, identified by its CAS number 937601-79-1, is a chemical compound that features a piperidine ring substituted with a carboxylic acid group and a cyanophenyl moiety. This compound typically exhibits characteristics common to piperidine derivatives, including potential basicity due to the nitrogen atom in the ring. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may exhibit solubility in polar solvents. The cyanophenyl group introduces a cyano functional group, which can enhance the compound's reactivity and may influence its electronic properties. This compound may be of interest in medicinal chemistry for its potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the structural features may allow for interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, its stability, reactivity, and solubility will depend on environmental conditions such as pH and temperature.
Formula:C13H14N2O2
InChI:InChI=1S/C13H14N2O2/c14-9-11-3-1-2-4-12(11)15-7-5-10(6-8-15)13(16)17/h1-4,10H,5-8H2,(H,16,17)
InChI key:InChIKey=UPPMSPCFXVKLNW-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1)N2CCC(C(O)=O)CC2
Synonyms:
  • 1-(2-Cyanophenyl)-4-piperidinecarboxylic acid
  • 4-Piperidinecarboxylic acid, 1-(2-cyanophenyl)-
Found 3 products.