CymitQuimica logo

CAS 937816-91-6

:

1-(2-Amino-5-bromo-4-chlorophenyl)ethanone

Description:
1-(2-Amino-5-bromo-4-chlorophenyl)ethanone, with the CAS number 937816-91-6, is an organic compound characterized by its functional groups and structural features. It contains an ethanone moiety, indicating the presence of a ketone group, and an amino group attached to a phenyl ring that is further substituted with bromine and chlorine atoms. This compound is likely to exhibit polar characteristics due to the presence of the amino and carbonyl groups, which can engage in hydrogen bonding. The halogen substituents (bromine and chlorine) can influence the compound's reactivity, stability, and lipophilicity. Additionally, the presence of the amino group suggests potential for basicity and participation in various chemical reactions, such as nucleophilic substitutions. The compound may also possess biological activity, making it of interest in medicinal chemistry and drug development. Overall, its unique combination of functional groups and substituents contributes to its chemical behavior and potential applications in various fields.
Formula:C8H7BrClNO
InChI:InChI=1S/C8H7BrClNO/c1-4(12)5-2-6(9)7(10)3-8(5)11/h2-3H,11H2,1H3
InChI key:InChIKey=CNACMPFJLFHELK-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(N)C=C(Cl)C(Br)=C1
Synonyms:
  • Ethanone, 1-(2-amino-5-bromo-4-chlorophenyl)-
  • 1-(2-Amino-5-bromo-4-chlorophenyl)ethan-1-one
  • 1-(2-Amino-5-bromo-4-chlorophenyl)ethanone
Found 3 products.