CymitQuimica logo

CAS 939400-34-7

:

trans-3-(tert-butoxycarbonylamino)cyclobutanecarboxylic acid

Description:
Trans-3-(tert-butoxycarbonylamino)cyclobutanecarboxylic acid is a chemical compound characterized by its unique cyclobutane ring structure, which contributes to its rigidity and potential reactivity. The presence of the tert-butoxycarbonyl (Boc) group serves as a protective moiety for the amino group, making it useful in peptide synthesis and other organic transformations. This compound features both carboxylic acid and amine functional groups, which can participate in various chemical reactions, including esterification and amidation. The trans configuration of the substituents around the cyclobutane ring influences its stereochemistry and can affect its biological activity and interactions. Additionally, the compound's solubility and stability are influenced by the bulky tert-butoxycarbonyl group, which can impact its behavior in different solvents and under various conditions. Overall, trans-3-(tert-butoxycarbonylamino)cyclobutanecarboxylic acid is a versatile intermediate in organic synthesis, particularly in the field of medicinal chemistry and drug development.
Formula:C10H17NO4
InChI:InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-7-4-6(5-7)8(12)13/h6-7H,4-5H2,1-3H3,(H,11,14)(H,12,13)
InChI key:KLCYDBAYYYVNFM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1CC(C1)C(=O)O
Found 7 products.