CymitQuimica logo

CAS 93951-73-6

:

Phen-2,3,4,5-d4-ol, 6-chloro-

Description:
Phen-2,3,4,5-d4-ol, 6-chloro- is a deuterated derivative of phenol, where the hydrogen atoms at positions 2, 3, 4, and 5 of the phenolic ring are replaced with deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, including its mass and potentially its reactivity. The presence of a chlorine atom at the 6-position introduces a halogen, which can influence the compound's electrophilic and nucleophilic characteristics. Deuterated compounds like this are often used in research, particularly in NMR spectroscopy, as they provide clearer spectral data due to the reduced background noise from hydrogen. The compound is likely to exhibit typical phenolic properties, such as acidity and the ability to participate in hydrogen bonding, while the deuteration may affect its solubility and interaction with other substances. Overall, Phen-2,3,4,5-d4-ol, 6-chloro- serves as a valuable tool in various chemical and biochemical applications.
Formula:C6HClD4O
InChI:InChI=1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8H/i1D,2D,3D,4D
InChI key:InChIKey=ISPYQTSUDJAMAB-RHQRLBAQSA-N
SMILES:ClC1=C(O)C(=C(C(=C1[2H])[2H])[2H])[2H]
Synonyms:
  • Phen-2,3,4,5-d4-ol, 6-chloro-
  • 2-Chlorophenol-d4
Found 6 products.