CymitQuimica logo

CAS 93952-23-9

:

1,1'-Biphenyl-2,2',3,3',6,6'-d6,4,4',5,5'-tetrachloro- (9CI)

Description:
1,1'-Biphenyl-2,2',3,3',6,6'-d6,4,4',5,5'-tetrachloro- (CAS 93952-23-9) is a deuterated derivative of biphenyl, characterized by the substitution of four chlorine atoms at specific positions on the biphenyl structure and the incorporation of deuterium atoms. This compound is typically used in research applications, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy, where the presence of deuterium enhances signal clarity and resolution. The chlorinated biphenyl structure contributes to its hydrophobic nature and potential environmental persistence. It is important to note that chlorinated biphenyls can exhibit toxicological effects, and their environmental impact is a subject of concern due to bioaccumulation and potential endocrine disruption. Handling this compound requires adherence to safety protocols to mitigate exposure risks. Overall, 1,1'-Biphenyl-2,2',3,3',6,6'-d6,4,4',5,5'-tetrachloro- serves as a valuable tool in chemical research, particularly in the fields of organic chemistry and environmental science.
Formula:C12Cl4D6
InChI:InChI=1S/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H/i1D,2D,3D,4D,5D,6D
InChI key:UQMGJOKDKOLIDP-MZWXYZOWSA-N
SMILES:[2H]C1=C(C(=C(C(=C1C2=C(C(=C(C(=C2[2H])[2H])Cl)Cl)[2H])[2H])Cl)Cl)[2H]
Synonyms:
  • 3,3’,4,4’-Tetrachlorodiphenyl-D6
Found 6 products.