CAS 93957-49-4
:3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole
Description:
3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole, identified by its CAS number 93957-49-4, is a chemical compound that belongs to the indole family, which is characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This particular compound features a 4-fluorophenyl group and an isopropyl group attached to the indole core, contributing to its unique chemical properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. The indole structure is known for its role in various biological systems and can serve as a scaffold for drug development. Additionally, the compound may exhibit interesting pharmacological properties, potentially acting as a ligand for various receptors or enzymes. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be studied for its potential applications in pharmaceuticals or agrochemicals. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H16FN
InChI:InChI=1S/C17H16FN/c1-12(2)19-11-16(13-7-9-14(18)10-8-13)15-5-3-4-6-17(15)19/h3-12H,1-2H3
InChI key:InChIKey=ZDZJOIIBECYKAJ-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=C(C=2C1=CC=CC2)C3=CC=C(F)C=C3
Synonyms:- 1H-Indole, 3-(4-fluorophenyl)-1-(1-methylethyl)-
- 3-(4-3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol
- 3-(4-Fluorobenzene)-1-(1-methylethyl)-1-H-indole
- 3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole
- 3-(4-Fluorophenyl)-1-Isopropyl-1H-Indole
- 3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indole
- Fluvastatin sodium intermediate F1
- N-isopropyl-3-(4-fluorophenyl)-1H-indole
- 1-Isopropyl-3-(4-fluorophenyl)indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(4-Fluorophenyl)-1-isopropyl-1H-indole
CAS:Formula:C17H16FNPurity:98%Color and Shape:SolidMolecular weight:253.3140(4-Fluorophenyl)-1-isopropyl-3-indole
CAS:(4-Fluorophenyl)-1-isopropyl-3-indoleFormula:C17H16FNPurity:99%Color and Shape:SolidMolecular weight:253.314043-(4-Fluorophenyl)-1-isopropylindole
CAS:Formula:C17H16FNPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:253.321-Isopropyl-3-(4-fluorophenyl)indole
CAS:1-Isopropyl-3-(4-fluorophenyl)indole is a solvent that has been shown to be useful for the deuterium enrichment of carbonyl compounds. It is also used as a reagent for the Friedel-Crafts acylation and for the synthesis of 3-methoxyacrylate. The process of wastewater treatment is made more efficient by adding 1-isopropyl-3-(4-fluorophenyl)indole to chloride. This process increases yields and decreases the amount of time it takes to complete wastewater treatment. 1-Isopropyl-3-(4-fluorophenyl)indole can also be used in the synthesis of fluvastatin, an antilipidemic agent.Formula:C17H16FNPurity:Min. 95%Color and Shape:PowderMolecular weight:253.31 g/mol1-Isopropyl-3-(4-fluorophenyl)indole-d7
CAS:Controlled ProductApplications 1-Isopropyl-3-(4-fluorophenyl)indole-d7 is an isotope labelled derivative of Fluvastatin (F601250), a synthetic HMG-CoA reductase inhibitor.
References Tse, F.L.S., et al.: J. Clin. Pharmacol., 32, 630 (1992); Dain, J.G., et al.: Drug Metab. Disposit., 21, 567 (1993)Formula:C17D7H9FNColor and Shape:NeatMolecular weight:260.3573-(4-Fluorophenyl)-1-isopropyl-1H-indole
CAS:Formula:C17H16FNPurity:98%Color and Shape:SolidMolecular weight:253.32





